About sodium;1-chloro-2-(trifluoromethyl)benzene;hydride
sodium;1-chloro-2-(trifluoromethyl)benzene;hydride (PubChem CID 175454034) has the molecular formula C7H5ClF3Na
and a molecular weight of 204.55 g/mol. Its IUPAC name is sodium;1-chloro-2-(trifluoromethyl)benzene;hydride.
Molecular Properties
| Compound Name | sodium;1-chloro-2-(trifluoromethyl)benzene;hydride |
| PubChem CID | 175454034 |
| Molecular Formula | C7H5ClF3Na |
| Molecular Weight | 204.55 g/mol |
| Exact Mass | 203.99 |
| IUPAC Name | sodium;1-chloro-2-(trifluoromethyl)benzene;hydride |
| SMILES | FC(F)(F)c1ccccc1Cl.[H-].[Na+] |
| InChI | InChI=1S/C7H4ClF3.Na.H/c8-6-4-2-1-3-5(6)7(9,10)11;;/h1-4H;;/q;+1;-1 |
| InChIKey | BQNGHGGAQWJLSY-UHFFFAOYSA-N |
| XLogP | 0.48 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 204.55 |
| LogP ≤ 5 | 0.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Analyze sodium;1-chloro-2-(trifluoromethyl)benzene;hydride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of sodium;1-chloro-2-(trifluoromethyl)benzene;hydride?
The IUPAC name of sodium;1-chloro-2-(trifluoromethyl)benzene;hydride (CID 175454034) is sodium;1-chloro-2-(trifluoromethyl)benzene;hydride.
What is the SMILES notation for sodium;1-chloro-2-(trifluoromethyl)benzene;hydride?
The canonical SMILES for sodium;1-chloro-2-(trifluoromethyl)benzene;hydride is FC(F)(F)c1ccccc1Cl.[H-].[Na+].
What is the InChIKey of sodium;1-chloro-2-(trifluoromethyl)benzene;hydride?
The InChIKey is BQNGHGGAQWJLSY-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H4ClF3.Na.H/c8-6-4-2-1-3-5(6)7(9,10)11;;/h1-4H;;/q;+1;-1.
What are the key properties of sodium;1-chloro-2-(trifluoromethyl)benzene;hydride?
sodium;1-chloro-2-(trifluoromethyl)benzene;hydride has a molecular weight of 204.55 g/mol, XLogP of 0.48, 0 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for sodium;1-chloro-2-(trifluoromethyl)benzene;hydride is sourced from PubChem (CID 175454034), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).