C15H8Cl2F6 — CID 22336549
1-chloro-2-[1-(2-chlorophenyl)-1,2,2,3,3,3-hexafluoropropyl]benzene (PubChem CID 22336549) has the molecular formula C15H8Cl2F6 and a molecular weight of 373.12 g/mol. Its IUPAC name is 1-chloro-2-[1-(2-chlorophenyl)-1,2,2,3,3,3-hexafluoropropyl]benzene.
| Compound Name | 1-chloro-2-[1-(2-chlorophenyl)-1,2,2,3,3,3-hexafluoropropyl]benzene |
|---|---|
| PubChem CID | 22336549 |
| Molecular Formula | C15H8Cl2F6 |
| Molecular Weight | 373.12 g/mol |
| Exact Mass | 371.99 |
| IUPAC Name | 1-chloro-2-[1-(2-chlorophenyl)-1,2,2,3,3,3-hexafluoropropyl]benzene |
| SMILES | FC(F)(F)C(F)(F)C(F)(c1ccccc1Cl)c1ccccc1Cl |
| InChI | InChI=1S/C15H8Cl2F6/c16-11-7-3-1-5-9(11)13(18,14(19,20)15(21,22)23)10-6-2-4-8-12(10)17/h1-8H |
| InChIKey | CZXMOXFBKRTGLY-UHFFFAOYSA-N |
| XLogP | 6.40 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.12 |
| LogP ≤ 5 | 6.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|