C14H9ClF5NO — CID 162511344
1-(2-chlorophenyl)-2,2,3,3,3-pentafluoro-1-pyridin-2-ylpropan-1-ol (PubChem CID 162511344) has the molecular formula C14H9ClF5NO and a molecular weight of 337.68 g/mol. Its IUPAC name is 1-(2-chlorophenyl)-2,2,3,3,3-pentafluoro-1-pyridin-2-ylpropan-1-ol.
| Compound Name | 1-(2-chlorophenyl)-2,2,3,3,3-pentafluoro-1-pyridin-2-ylpropan-1-ol |
|---|---|
| PubChem CID | 162511344 |
| Molecular Formula | C14H9ClF5NO |
| Molecular Weight | 337.68 g/mol |
| Exact Mass | 337.03 |
| IUPAC Name | 1-(2-chlorophenyl)-2,2,3,3,3-pentafluoro-1-pyridin-2-ylpropan-1-ol |
| SMILES | OC(c1ccccn1)(c1ccccc1Cl)C(F)(F)C(F)(F)F |
| InChI | InChI=1S/C14H9ClF5NO/c15-10-6-2-1-5-9(10)12(22,11-7-3-4-8-21-11)13(16,17)14(18,19)20/h1-8,22H |
| InChIKey | VSKWFEUBZRTEOO-UHFFFAOYSA-N |
| XLogP | 4.17 |
| TPSA | 33.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.68 |
| LogP ≤ 5 | 4.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|