2-(2-chlorophenyl)-2,2-difluoroacetyl fluoride

C8H4ClF3O — CID 118255532

IUPAC2-(2-chlorophenyl)-2,2-difluoroacetyl fluoride
SMILESO=C(F)C(F)(F)c1ccccc1Cl
InChIInChI=1S/C8H4ClF3O/c9-6-4-2-1-3-5(6)8(11,12)7(10)13/h1-4H
InChIKeyRLOOKPAOVWCPCF-UHFFFAOYSA-N
MW208.57 g/mol
LogP2.93
Rot. Bonds2

About 2-(2-chlorophenyl)-2,2-difluoroacetyl fluoride

2-(2-chlorophenyl)-2,2-difluoroacetyl fluoride (PubChem CID 118255532) has the molecular formula C8H4ClF3O and a molecular weight of 208.57 g/mol. Its IUPAC name is 2-(2-chlorophenyl)-2,2-difluoroacetyl fluoride.

Molecular Properties

Compound Name2-(2-chlorophenyl)-2,2-difluoroacetyl fluoride
PubChem CID118255532
Molecular FormulaC8H4ClF3O
Molecular Weight208.57 g/mol
Exact Mass207.99
IUPAC Name2-(2-chlorophenyl)-2,2-difluoroacetyl fluoride
SMILESO=C(F)C(F)(F)c1ccccc1Cl
InChIInChI=1S/C8H4ClF3O/c9-6-4-2-1-3-5(6)8(11,12)7(10)13/h1-4H
InChIKeyRLOOKPAOVWCPCF-UHFFFAOYSA-N
XLogP2.93
TPSA17.07 Ų
H-Bond Donors
H-Bond Acceptors1
Rotatable Bonds2
Heavy Atoms13
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500208.57
LogP ≤ 52.93
H-Bond Donors ≤ 50
H-Bond Acceptors ≤ 101

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'acid_halide', 'substructure': 'N/A'}

Analyze 2-(2-chlorophenyl)-2,2-difluoroacetyl fluoride with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 2-(2-chlorophenyl)-2,2-difluoroacetyl fluoride?
The IUPAC name of 2-(2-chlorophenyl)-2,2-difluoroacetyl fluoride (CID 118255532) is 2-(2-chlorophenyl)-2,2-difluoroacetyl fluoride.
What is the SMILES notation for 2-(2-chlorophenyl)-2,2-difluoroacetyl fluoride?
The canonical SMILES for 2-(2-chlorophenyl)-2,2-difluoroacetyl fluoride is O=C(F)C(F)(F)c1ccccc1Cl.
What is the InChIKey of 2-(2-chlorophenyl)-2,2-difluoroacetyl fluoride?
The InChIKey is RLOOKPAOVWCPCF-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H4ClF3O/c9-6-4-2-1-3-5(6)8(11,12)7(10)13/h1-4H.
What are the key properties of 2-(2-chlorophenyl)-2,2-difluoroacetyl fluoride?
2-(2-chlorophenyl)-2,2-difluoroacetyl fluoride has a molecular weight of 208.57 g/mol, XLogP of 2.93, 2 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(2-chlorophenyl)-2,2-difluoroacetyl fluoride is sourced from PubChem (CID 118255532), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).