C8H4ClF3O — CID 2757931
1-(3-chlorophenyl)-2,2,2-trifluoroethanone (PubChem CID 2757931) has the molecular formula C8H4ClF3O and a molecular weight of 208.57 g/mol. Its IUPAC name is 1-(3-chlorophenyl)-2,2,2-trifluoroethanone.
| Compound Name | 1-(3-chlorophenyl)-2,2,2-trifluoroethanone |
|---|---|
| PubChem CID | 2757931 |
| Molecular Formula | C8H4ClF3O |
| Molecular Weight | 208.57 g/mol |
| Exact Mass | 207.99 |
| IUPAC Name | 1-(3-chlorophenyl)-2,2,2-trifluoroethanone |
| SMILES | O=C(c1cccc(Cl)c1)C(F)(F)F |
| InChI | InChI=1S/C8H4ClF3O/c9-6-3-1-2-5(4-6)7(13)8(10,11)12/h1-4H |
| InChIKey | KYFMLRJTDPGABF-UHFFFAOYSA-N |
| XLogP | 3.09 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 208.57 |
| LogP ≤ 5 | 3.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |