C36H26N3Pt- — CID 58401833
4-methyl-2-(4-methyl-2-pyridinyl)pyridine;platinum;spiro[9H-indeno[1,2-b]pyridin-9-ide-5,9'-fluorene] (PubChem CID 58401833) has the molecular formula C36H26N3Pt- and a molecular weight of 695.70 g/mol. Its IUPAC name is 4-methyl-2-(4-methyl-2-pyridinyl)pyridine;platinum;spiro[9H-indeno[1,2-b]pyridin-9-ide-5,9'-fluorene].
| Compound Name | 4-methyl-2-(4-methyl-2-pyridinyl)pyridine;platinum;spiro[9H-indeno[1,2-b]pyridin-9-ide-5,9'-fluorene] |
|---|---|
| PubChem CID | 58401833 |
| Molecular Formula | C36H26N3Pt- |
| Molecular Weight | 695.70 g/mol |
| Exact Mass | 695.18 |
| IUPAC Name | 4-methyl-2-(4-methyl-2-pyridinyl)pyridine;platinum;spiro[9H-indeno[1,2-b]pyridin-9-ide-5,9'-fluorene] |
| SMILES | Cc1ccnc(-c2cc(C)ccn2)c1.[Pt].[c-]1cccc2c1-c1ncccc1C21c2ccccc2-c2ccccc21 |
| InChI | InChI=1S/C24H14N.C12H12N2.Pt/c1-4-11-19-16(8-1)17-9-2-5-12-20(17)24(19)21-13-6-3-10-18(21)23-22(24)14-7-15-25-23;1-9-3-5-13-11(7-9)12-8-10(2)4-6-14-12;/h1-9,11-15H;3-8H,1-2H3;/q-1;; |
| InChIKey | JSQYTHDUIGFIBL-UHFFFAOYSA-N |
| XLogP | 7.98 |
| TPSA | 38.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 695.70 |
| LogP ≤ 5 | 7.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|