C50H32N2Pt — CID 59661583
bis(7-methylspiro[9H-indeno[1,2-b]pyridin-9-ide-5,9'-fluorene]);platinum(2+) (PubChem CID 59661583) has the molecular formula C50H32N2Pt and a molecular weight of 855.90 g/mol. Its IUPAC name is bis(7-methylspiro[9H-indeno[1,2-b]pyridin-9-ide-5,9'-fluorene]);platinum(2+).
| Compound Name | bis(7-methylspiro[9H-indeno[1,2-b]pyridin-9-ide-5,9'-fluorene]);platinum(2+) |
|---|---|
| PubChem CID | 59661583 |
| Molecular Formula | C50H32N2Pt |
| Molecular Weight | 855.90 g/mol |
| Exact Mass | 855.22 |
| IUPAC Name | bis(7-methylspiro[9H-indeno[1,2-b]pyridin-9-ide-5,9'-fluorene]);platinum(2+) |
| SMILES | Cc1c[c-]c2c(c1)C1(c3ccccc3-c3ccccc31)c1cccnc1-2.Cc1c[c-]c2c(c1)C1(c3ccccc3-c3ccccc31)c1cccnc1-2.[Pt+2] |
| InChI | InChI=1S/2C25H16N.Pt/c2*1-16-12-13-19-23(15-16)25(22-11-6-14-26-24(19)22)20-9-4-2-7-17(20)18-8-3-5-10-21(18)25;/h2*2-12,14-15H,1H3;/q2*-1;+2 |
| InChIKey | CGLJPNKRODLACP-UHFFFAOYSA-N |
| XLogP | 11.06 |
| TPSA | 25.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 53 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 855.90 |
| LogP ≤ 5 | 11.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|