C34H28Y-2 — CID 161215177
9,9-di(phenyl)fluorene;1,3,5-trimethylbenzene;yttrium (PubChem CID 161215177) has the molecular formula C34H28Y-2 and a molecular weight of 525.50 g/mol. Its IUPAC name is 9,9-di(phenyl)fluorene;1,3,5-trimethylbenzene;yttrium.
| Compound Name | 9,9-di(phenyl)fluorene;1,3,5-trimethylbenzene;yttrium |
|---|---|
| PubChem CID | 161215177 |
| Molecular Formula | C34H28Y-2 |
| Molecular Weight | 525.50 g/mol |
| Exact Mass | 525.13 |
| IUPAC Name | 9,9-di(phenyl)fluorene;1,3,5-trimethylbenzene;yttrium |
| SMILES | Cc1cc(C)cc(C)c1.[Y].[c-]1ccccc1C1(c2[c-]cccc2)c2ccccc2-c2ccccc21 |
| InChI | InChI=1S/C25H16.C9H12.Y/c1-3-11-19(12-4-1)25(20-13-5-2-6-14-20)23-17-9-7-15-21(23)22-16-8-10-18-24(22)25;1-7-4-8(2)6-9(3)5-7;/h1-11,13,15-18H;4-6H,1-3H3;/q-2;; |
| InChIKey | FMBBZWIAASADIL-UHFFFAOYSA-N |
| XLogP | 8.26 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 525.50 |
| LogP ≤ 5 | 8.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|