C51H44N6 — CID 58142146
2-[9-[4,6-bis(3,5-dimethylphenyl)-1,3,5-triazin-2-yl]fluoren-9-yl]-4,6-bis(3,5-dimethylphenyl)-1,3,5-triazine (PubChem CID 58142146) has the molecular formula C51H44N6 and a molecular weight of 740.95 g/mol. Its IUPAC name is 2-[9-[4,6-bis(3,5-dimethylphenyl)-1,3,5-triazin-2-yl]fluoren-9-yl]-4,6-bis(3,5-dimethylphenyl)-1,3,5-triazine.
| Compound Name | 2-[9-[4,6-bis(3,5-dimethylphenyl)-1,3,5-triazin-2-yl]fluoren-9-yl]-4,6-bis(3,5-dimethylphenyl)-1,3,5-triazine |
|---|---|
| PubChem CID | 58142146 |
| Molecular Formula | C51H44N6 |
| Molecular Weight | 740.95 g/mol |
| Exact Mass | 740.36 |
| IUPAC Name | 2-[9-[4,6-bis(3,5-dimethylphenyl)-1,3,5-triazin-2-yl]fluoren-9-yl]-4,6-bis(3,5-dimethylphenyl)-1,3,5-triazine |
| SMILES | Cc1cc(C)cc(-c2nc(-c3cc(C)cc(C)c3)nc(C3(c4nc(-c5cc(C)cc(C)c5)nc(-c5cc(C)cc(C)c5)n4)c4ccccc4-c4ccccc43)n2)c1 |
| InChI | InChI=1S/C51H44N6/c1-29-17-30(2)22-37(21-29)45-52-46(38-23-31(3)18-32(4)24-38)55-49(54-45)51(43-15-11-9-13-41(43)42-14-10-12-16-44(42)51)50-56-47(39-25-33(5)19-34(6)26-39)53-48(57-50)40-27-35(7)20-36(8)28-40/h9-28H,1-8H3 |
| InChIKey | VZXZQCGVEFHRAC-UHFFFAOYSA-N |
| XLogP | 11.56 |
| TPSA | 77.34 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 57 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 740.95 |
| LogP ≤ 5 | 11.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |