C67H44N6 — CID 170367767
2-(3,5-diphenylphenyl)-4-[9-[4-(3,5-diphenylphenyl)-6-phenyl-1,3,5-triazin-2-yl]fluoren-9-yl]-6-phenyl-1,3,5-triazine (PubChem CID 170367767) has the molecular formula C67H44N6 and a molecular weight of 933.13 g/mol. Its IUPAC name is 2-(3,5-diphenylphenyl)-4-[9-[4-(3,5-diphenylphenyl)-6-phenyl-1,3,5-triazin-2-yl]fluoren-9-yl]-6-phenyl-1,3,5-triazine.
| Compound Name | 2-(3,5-diphenylphenyl)-4-[9-[4-(3,5-diphenylphenyl)-6-phenyl-1,3,5-triazin-2-yl]fluoren-9-yl]-6-phenyl-1,3,5-triazine |
|---|---|
| PubChem CID | 170367767 |
| Molecular Formula | C67H44N6 |
| Molecular Weight | 933.13 g/mol |
| Exact Mass | 932.36 |
| IUPAC Name | 2-(3,5-diphenylphenyl)-4-[9-[4-(3,5-diphenylphenyl)-6-phenyl-1,3,5-triazin-2-yl]fluoren-9-yl]-6-phenyl-1,3,5-triazine |
| SMILES | c1ccc(-c2cc(-c3ccccc3)cc(-c3nc(-c4ccccc4)nc(C4(c5nc(-c6ccccc6)nc(-c6cc(-c7ccccc7)cc(-c7ccccc7)c6)n5)c5ccccc5-c5ccccc54)n3)c2)cc1 |
| InChI | InChI=1S/C67H44N6/c1-7-23-45(24-8-1)51-39-52(46-25-9-2-10-26-46)42-55(41-51)63-68-61(49-31-15-5-16-32-49)70-65(72-63)67(59-37-21-19-35-57(59)58-36-20-22-38-60(58)67)66-71-62(50-33-17-6-18-34-50)69-64(73-66)56-43-53(47-27-11-3-12-28-47)40-54(44-56)48-29-13-4-14-30-48/h1-44H |
| InChIKey | ZRLAGGJXADTSRC-UHFFFAOYSA-N |
| XLogP | 15.76 |
| TPSA | 77.34 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 73 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 933.13 |
| LogP ≤ 5 | 15.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |