C25H16K- — CID 164818801
potassium 9,9-di(phenyl)fluorene (PubChem CID 164818801) has the molecular formula C25H16K- and a molecular weight of 355.50 g/mol. Its IUPAC name is potassium 9,9-di(phenyl)fluorene.
| Compound Name | potassium 9,9-di(phenyl)fluorene |
|---|---|
| PubChem CID | 164818801 |
| Molecular Formula | C25H16K- |
| Molecular Weight | 355.50 g/mol |
| Exact Mass | 355.09 |
| IUPAC Name | potassium 9,9-di(phenyl)fluorene |
| SMILES | [K+].[c-]1ccccc1C1(c2[c-]cccc2)c2ccccc2-c2ccccc21 |
| InChI | InChI=1S/C25H16.K/c1-3-11-19(12-4-1)25(20-13-5-2-6-14-20)23-17-9-7-15-21(23)22-16-8-10-18-24(22)25;/h1-11,13,15-18H;/q-2;+1 |
| InChIKey | LOQHIPLZYCBMDA-UHFFFAOYSA-N |
| XLogP | 2.65 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.50 |
| LogP ≤ 5 | 2.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|