C34H30IrN2O2-2 — CID 170514487
iridium;pentane-2,4-diol;(9S)-9-phenyl-9-(3-pyridin-2-ylbenzene-2-id-1-yl)indeno[2,1-b]pyridine (PubChem CID 170514487) has the molecular formula C34H30IrN2O2-2 and a molecular weight of 690.84 g/mol. Its IUPAC name is iridium;pentane-2,4-diol;(9S)-9-phenyl-9-(3-pyridin-2-ylbenzene-2-id-1-yl)indeno[2,1-b]pyridine.
| Compound Name | iridium;pentane-2,4-diol;(9S)-9-phenyl-9-(3-pyridin-2-ylbenzene-2-id-1-yl)indeno[2,1-b]pyridine |
|---|---|
| PubChem CID | 170514487 |
| Molecular Formula | C34H30IrN2O2-2 |
| Molecular Weight | 690.84 g/mol |
| Exact Mass | 691.19 |
| IUPAC Name | iridium;pentane-2,4-diol;(9S)-9-phenyl-9-(3-pyridin-2-ylbenzene-2-id-1-yl)indeno[2,1-b]pyridine |
| SMILES | CC(O)CC(C)O.[Ir].[c-]1ccccc1[C@]1(c2[c-]c(-c3ccccn3)ccc2)c2ccccc2-c2cccnc21 |
| InChI | InChI=1S/C29H18N2.C5H12O2.Ir/c1-2-11-22(12-3-1)29(23-13-8-10-21(20-23)27-17-6-7-18-30-27)26-16-5-4-14-24(26)25-15-9-19-31-28(25)29;1-4(6)3-5(2)7;/h1-11,13-19H;4-7H,3H2,1-2H3;/q-2;;/t29-;;/m0../s1 |
| InChIKey | SBRVCFGEGAHTJI-UJXPALLWSA-N |
| XLogP | 6.24 |
| TPSA | 66.24 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 690.84 |
| LogP ≤ 5 | 6.24 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|