C55H47N3Pt — CID 155614478
4-tert-butyl-2-[9-[2-(3-tert-butylbenzene-6-id-1-yl)-1-methylimidazol-4-yl]fluoren-9-yl]-6-(9-phenylfluoren-9-yl)pyridine;platinum(2+) (PubChem CID 155614478) has the molecular formula C55H47N3Pt and a molecular weight of 945.08 g/mol. Its IUPAC name is 4-tert-butyl-2-[9-[2-(3-tert-butylbenzene-6-id-1-yl)-1-methylimidazol-4-yl]fluoren-9-yl]-6-(9-phenylfluoren-9-yl)pyridine;platinum(2+).
| Compound Name | 4-tert-butyl-2-[9-[2-(3-tert-butylbenzene-6-id-1-yl)-1-methylimidazol-4-yl]fluoren-9-yl]-6-(9-phenylfluoren-9-yl)pyridine;platinum(2+) |
|---|---|
| PubChem CID | 155614478 |
| Molecular Formula | C55H47N3Pt |
| Molecular Weight | 945.08 g/mol |
| Exact Mass | 944.34 |
| IUPAC Name | 4-tert-butyl-2-[9-[2-(3-tert-butylbenzene-6-id-1-yl)-1-methylimidazol-4-yl]fluoren-9-yl]-6-(9-phenylfluoren-9-yl)pyridine;platinum(2+) |
| SMILES | Cn1cc(C2(c3cc(C(C)(C)C)cc(C4(c5[c-]cccc5)c5ccccc5-c5ccccc54)n3)c3ccccc3-c3ccccc32)nc1-c1[c-]ccc(C(C)(C)C)c1.[Pt+2] |
| InChI | InChI=1S/C55H47N3.Pt/c1-52(2,3)38-23-19-20-36(32-38)51-57-50(35-58(51)7)55(46-30-17-13-26-42(46)43-27-14-18-31-47(43)55)49-34-39(53(4,5)6)33-48(56-49)54(37-21-9-8-10-22-37)44-28-15-11-24-40(44)41-25-12-16-29-45(41)54;/h8-19,21,23-35H,1-7H3;/q-2;+2 |
| InChIKey | RADXUUUXWOVTJC-UHFFFAOYSA-N |
| XLogP | 12.40 |
| TPSA | 30.71 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 59 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 945.08 |
| LogP ≤ 5 | 12.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|