C37H31N4OPt-3 — CID 155614515
CID 155614515 (PubChem CID 155614515) has the molecular formula C37H31N4OPt-3 and a molecular weight of 742.76 g/mol.
| Compound Name | CID 155614515 |
|---|---|
| PubChem CID | 155614515 |
| Molecular Formula | C37H31N4OPt-3 |
| Molecular Weight | 742.76 g/mol |
| Exact Mass | 742.22 |
| IUPAC Name | — |
| SMILES | CN1C=NN(c2[c-]c(Oc3cc(C(C)(C)C)cc(C4(c5[c-]cccc5)c5ccccc5-c5ccccc54)n3)ccc2)[CH-]1.[Pt] |
| InChI | InChI=1S/C37H31N4O.Pt/c1-36(2,3)27-21-34(39-35(22-27)42-29-16-12-15-28(23-29)41-25-40(4)24-38-41)37(26-13-6-5-7-14-26)32-19-10-8-17-30(32)31-18-9-11-20-33(31)37;/h5-13,15-22,24-25H,1-4H3;/q-3; |
| InChIKey | CMQAOQTWMZFTTL-UHFFFAOYSA-N |
| XLogP | 7.95 |
| TPSA | 40.96 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 742.76 |
| LogP ≤ 5 | 7.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|