C38H34N3O+ — CID 155113839
4-tert-butyl-2-[9-[3-(3-methylimidazol-3-ium-1-yl)phenyl]fluoren-9-yl]-6-phenoxypyridine (PubChem CID 155113839) has the molecular formula C38H34N3O+ and a molecular weight of 548.71 g/mol. Its IUPAC name is 4-tert-butyl-2-[9-[3-(3-methylimidazol-3-ium-1-yl)phenyl]fluoren-9-yl]-6-phenoxypyridine.
| Compound Name | 4-tert-butyl-2-[9-[3-(3-methylimidazol-3-ium-1-yl)phenyl]fluoren-9-yl]-6-phenoxypyridine |
|---|---|
| PubChem CID | 155113839 |
| Molecular Formula | C38H34N3O+ |
| Molecular Weight | 548.71 g/mol |
| Exact Mass | 548.27 |
| IUPAC Name | 4-tert-butyl-2-[9-[3-(3-methylimidazol-3-ium-1-yl)phenyl]fluoren-9-yl]-6-phenoxypyridine |
| SMILES | C[n+]1ccn(-c2cccc(C3(c4cc(C(C)(C)C)cc(Oc5ccccc5)n4)c4ccccc4-c4ccccc43)c2)c1 |
| InChI | InChI=1S/C38H34N3O/c1-37(2,3)28-24-35(39-36(25-28)42-30-15-6-5-7-16-30)38(27-13-12-14-29(23-27)41-22-21-40(4)26-41)33-19-10-8-17-31(33)32-18-9-11-20-34(32)38/h5-26H,1-4H3/q+1 |
| InChIKey | YMKOKTASJBSIDI-UHFFFAOYSA-N |
| XLogP | 8.15 |
| TPSA | 30.93 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 548.71 |
| LogP ≤ 5 | 8.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|