C27H23N4O+ — CID 155784480
N-[3-[3-(3-methylimidazol-3-ium-1-yl)phenoxy]phenyl]-N-phenylpyridin-2-amine (PubChem CID 155784480) has the molecular formula C27H23N4O+ and a molecular weight of 419.51 g/mol. Its IUPAC name is N-[3-[3-(3-methylimidazol-3-ium-1-yl)phenoxy]phenyl]-N-phenylpyridin-2-amine.
| Compound Name | N-[3-[3-(3-methylimidazol-3-ium-1-yl)phenoxy]phenyl]-N-phenylpyridin-2-amine |
|---|---|
| PubChem CID | 155784480 |
| Molecular Formula | C27H23N4O+ |
| Molecular Weight | 419.51 g/mol |
| Exact Mass | 419.19 |
| IUPAC Name | N-[3-[3-(3-methylimidazol-3-ium-1-yl)phenoxy]phenyl]-N-phenylpyridin-2-amine |
| SMILES | C[n+]1ccn(-c2cccc(Oc3cccc(N(c4ccccc4)c4ccccn4)c3)c2)c1 |
| InChI | InChI=1S/C27H23N4O/c1-29-17-18-30(21-29)23-11-7-13-25(19-23)32-26-14-8-12-24(20-26)31(22-9-3-2-4-10-22)27-15-5-6-16-28-27/h2-21H,1H3/q+1 |
| InChIKey | IUGBWWSRYKGKKL-UHFFFAOYSA-N |
| XLogP | 5.96 |
| TPSA | 34.17 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 419.51 |
| LogP ≤ 5 | 5.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|