C29H21N4O+ — CID 134274377
4-[3-(3-methylimidazol-3-ium-1-yl)phenoxy]-1,19-diazapentacyclo[10.8.1.02,7.08,21.015,20]henicosa-2(7),3,5,8,10,12(21),13,15(20),16,18-decaene (PubChem CID 134274377) has the molecular formula C29H21N4O+ and a molecular weight of 441.51 g/mol. Its IUPAC name is 4-[3-(3-methylimidazol-3-ium-1-yl)phenoxy]-1,19-diazapentacyclo[10.8.1.02,7.08,21.015,20]henicosa-2(7),3,5,8,10,12(21),13,15(20),16,18-decaene.
| Compound Name | 4-[3-(3-methylimidazol-3-ium-1-yl)phenoxy]-1,19-diazapentacyclo[10.8.1.02,7.08,21.015,20]henicosa-2(7),3,5,8,10,12(21),13,15(20),16,18-decaene |
|---|---|
| PubChem CID | 134274377 |
| Molecular Formula | C29H21N4O+ |
| Molecular Weight | 441.51 g/mol |
| Exact Mass | 441.17 |
| IUPAC Name | 4-[3-(3-methylimidazol-3-ium-1-yl)phenoxy]-1,19-diazapentacyclo[10.8.1.02,7.08,21.015,20]henicosa-2(7),3,5,8,10,12(21),13,15(20),16,18-decaene |
| SMILES | C[n+]1ccn(-c2cccc(Oc3ccc4c5cccc6c5n(c4c3)-c3ncccc3C=C6)c2)c1 |
| InChI | InChI=1S/C29H21N4O/c1-31-15-16-32(19-31)22-7-3-8-23(17-22)34-24-12-13-25-26-9-2-5-20-10-11-21-6-4-14-30-29(21)33(28(20)26)27(25)18-24/h2-19H,1H3/q+1 |
| InChIKey | VGSCOWJGPDDPAP-UHFFFAOYSA-N |
| XLogP | 6.07 |
| TPSA | 35.86 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 441.51 |
| LogP ≤ 5 | 6.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|