C41H40N8+4 — CID 102053425
1-methyl-3-[4-[tris[4-(3-methylimidazol-3-ium-1-yl)phenyl]methyl]phenyl]imidazol-1-ium (PubChem CID 102053425) has the molecular formula C41H40N8+4 and a molecular weight of 644.83 g/mol. Its IUPAC name is 1-methyl-3-[4-[tris[4-(3-methylimidazol-3-ium-1-yl)phenyl]methyl]phenyl]imidazol-1-ium.
| Compound Name | 1-methyl-3-[4-[tris[4-(3-methylimidazol-3-ium-1-yl)phenyl]methyl]phenyl]imidazol-1-ium |
|---|---|
| PubChem CID | 102053425 |
| Molecular Formula | C41H40N8+4 |
| Molecular Weight | 644.83 g/mol |
| Exact Mass | 644.34 |
| IUPAC Name | 1-methyl-3-[4-[tris[4-(3-methylimidazol-3-ium-1-yl)phenyl]methyl]phenyl]imidazol-1-ium |
| SMILES | C[n+]1ccn(-c2ccc(C(c3ccc(-n4cc[n+](C)c4)cc3)(c3ccc(-n4cc[n+](C)c4)cc3)c3ccc(-n4cc[n+](C)c4)cc3)cc2)c1 |
| InChI | InChI=1S/C41H40N8/c1-42-21-25-46(29-42)37-13-5-33(6-14-37)41(34-7-15-38(16-8-34)47-26-22-43(2)30-47,35-9-17-39(18-10-35)48-27-23-44(3)31-48)36-11-19-40(20-12-36)49-28-24-45(4)32-49/h5-32H,1-4H3/q+4 |
| InChIKey | MOTUQBKBXMNMAN-UHFFFAOYSA-N |
| XLogP | 4.53 |
| TPSA | 35.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 49 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 644.83 |
| LogP ≤ 5 | 4.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'}, {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|