C26H26N3+ — CID 122234360
1,3,6,8-tetramethyl-9-[4-(3-methylimidazol-3-ium-1-yl)phenyl]carbazole (PubChem CID 122234360) has the molecular formula C26H26N3+ and a molecular weight of 380.52 g/mol. Its IUPAC name is 1,3,6,8-tetramethyl-9-[4-(3-methylimidazol-3-ium-1-yl)phenyl]carbazole.
| Compound Name | 1,3,6,8-tetramethyl-9-[4-(3-methylimidazol-3-ium-1-yl)phenyl]carbazole |
|---|---|
| PubChem CID | 122234360 |
| Molecular Formula | C26H26N3+ |
| Molecular Weight | 380.52 g/mol |
| Exact Mass | 380.21 |
| IUPAC Name | 1,3,6,8-tetramethyl-9-[4-(3-methylimidazol-3-ium-1-yl)phenyl]carbazole |
| SMILES | Cc1cc(C)c2c(c1)c1cc(C)cc(C)c1n2-c1ccc(-n2cc[n+](C)c2)cc1 |
| InChI | InChI=1S/C26H26N3/c1-17-12-19(3)25-23(14-17)24-15-18(2)13-20(4)26(24)29(25)22-8-6-21(7-9-22)28-11-10-27(5)16-28/h6-16H,1-5H3/q+1 |
| InChIKey | ZWECRWAHWVQKKV-UHFFFAOYSA-N |
| XLogP | 5.63 |
| TPSA | 13.74 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.52 |
| LogP ≤ 5 | 5.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|