C51H46N5O4+ — CID 142611541
3-N,3-N,6-N,6-N-tetrakis(4-methoxyphenyl)-9-[[4-(3-methylimidazol-3-ium-1-yl)phenyl]methyl]carbazole-3,6-diamine (PubChem CID 142611541) has the molecular formula C51H46N5O4+ and a molecular weight of 792.96 g/mol. Its IUPAC name is 3-N,3-N,6-N,6-N-tetrakis(4-methoxyphenyl)-9-[[4-(3-methylimidazol-3-ium-1-yl)phenyl]methyl]carbazole-3,6-diamine.
| Compound Name | 3-N,3-N,6-N,6-N-tetrakis(4-methoxyphenyl)-9-[[4-(3-methylimidazol-3-ium-1-yl)phenyl]methyl]carbazole-3,6-diamine |
|---|---|
| PubChem CID | 142611541 |
| Molecular Formula | C51H46N5O4+ |
| Molecular Weight | 792.96 g/mol |
| Exact Mass | 792.35 |
| IUPAC Name | 3-N,3-N,6-N,6-N-tetrakis(4-methoxyphenyl)-9-[[4-(3-methylimidazol-3-ium-1-yl)phenyl]methyl]carbazole-3,6-diamine |
| SMILES | COc1ccc(N(c2ccc(OC)cc2)c2ccc3c(c2)c2cc(N(c4ccc(OC)cc4)c4ccc(OC)cc4)ccc2n3Cc2ccc(-n3cc[n+](C)c3)cc2)cc1 |
| InChI | InChI=1S/C51H46N5O4/c1-52-30-31-53(35-52)37-8-6-36(7-9-37)34-54-50-28-18-42(55(38-10-20-44(57-2)21-11-38)39-12-22-45(58-3)23-13-39)32-48(50)49-33-43(19-29-51(49)54)56(40-14-24-46(59-4)25-15-40)41-16-26-47(60-5)27-17-41/h6-33,35H,34H2,1-5H3/q+1 |
| InChIKey | DNEYISAAGLXHOC-UHFFFAOYSA-N |
| XLogP | 11.43 |
| TPSA | 57.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 60 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 792.96 |
| LogP ≤ 5 | 11.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|