About 1-(4-ethyl-2,4-dimethylhexan-2-yl)-3-(4-methoxyphenyl)imidazol-1-ium
1-(4-ethyl-2,4-dimethylhexan-2-yl)-3-(4-methoxyphenyl)imidazol-1-ium (PubChem CID 123869602) has the molecular formula C20H31N2O+
and a molecular weight of 315.48 g/mol. Its IUPAC name is 1-(4-ethyl-2,4-dimethylhexan-2-yl)-3-(4-methoxyphenyl)imidazol-1-ium.
Molecular Properties
| Compound Name | 1-(4-ethyl-2,4-dimethylhexan-2-yl)-3-(4-methoxyphenyl)imidazol-1-ium |
| PubChem CID | 123869602 |
| Molecular Formula | C20H31N2O+ |
| Molecular Weight | 315.48 g/mol |
| Exact Mass | 315.24 |
| IUPAC Name | 1-(4-ethyl-2,4-dimethylhexan-2-yl)-3-(4-methoxyphenyl)imidazol-1-ium |
| SMILES | CCC(C)(CC)CC(C)(C)[n+]1ccn(-c2ccc(OC)cc2)c1 |
| InChI | InChI=1S/C20H31N2O/c1-7-20(5,8-2)15-19(3,4)22-14-13-21(16-22)17-9-11-18(23-6)12-10-17/h9-14,16H,7-8,15H2,1-6H3/q+1 |
| InChIKey | FOFBWOQNDHAJMO-UHFFFAOYSA-N |
| XLogP | 4.72 |
| TPSA | 18.04 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 315.48 |
| LogP ≤ 5 | 4.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|
Analyze 1-(4-ethyl-2,4-dimethylhexan-2-yl)-3-(4-methoxyphenyl)imidazol-1-ium with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(4-ethyl-2,4-dimethylhexan-2-yl)-3-(4-methoxyphenyl)imidazol-1-ium?
The IUPAC name of 1-(4-ethyl-2,4-dimethylhexan-2-yl)-3-(4-methoxyphenyl)imidazol-1-ium (CID 123869602) is 1-(4-ethyl-2,4-dimethylhexan-2-yl)-3-(4-methoxyphenyl)imidazol-1-ium.
What is the SMILES notation for 1-(4-ethyl-2,4-dimethylhexan-2-yl)-3-(4-methoxyphenyl)imidazol-1-ium?
The canonical SMILES for 1-(4-ethyl-2,4-dimethylhexan-2-yl)-3-(4-methoxyphenyl)imidazol-1-ium is CCC(C)(CC)CC(C)(C)[n+]1ccn(-c2ccc(OC)cc2)c1.
What is the InChIKey of 1-(4-ethyl-2,4-dimethylhexan-2-yl)-3-(4-methoxyphenyl)imidazol-1-ium?
The InChIKey is FOFBWOQNDHAJMO-UHFFFAOYSA-N. The full InChI is InChI=1S/C20H31N2O/c1-7-20(5,8-2)15-19(3,4)22-14-13-21(16-22)17-9-11-18(23-6)12-10-17/h9-14,16H,7-8,15H2,1-6H3/q+1.
What are the key properties of 1-(4-ethyl-2,4-dimethylhexan-2-yl)-3-(4-methoxyphenyl)imidazol-1-ium?
1-(4-ethyl-2,4-dimethylhexan-2-yl)-3-(4-methoxyphenyl)imidazol-1-ium has a molecular weight of 315.48 g/mol, XLogP of 4.72, 7 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(4-ethyl-2,4-dimethylhexan-2-yl)-3-(4-methoxyphenyl)imidazol-1-ium is sourced from PubChem (CID 123869602), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).