C15H21N2O+ — CID 101396789
1-tert-butyl-3-[(4-methoxyphenyl)methyl]imidazol-3-ium (PubChem CID 101396789) has the molecular formula C15H21N2O+ and a molecular weight of 245.35 g/mol. Its IUPAC name is 1-tert-butyl-3-[(4-methoxyphenyl)methyl]imidazol-3-ium.
| Compound Name | 1-tert-butyl-3-[(4-methoxyphenyl)methyl]imidazol-3-ium |
|---|---|
| PubChem CID | 101396789 |
| Molecular Formula | C15H21N2O+ |
| Molecular Weight | 245.35 g/mol |
| Exact Mass | 245.16 |
| IUPAC Name | 1-tert-butyl-3-[(4-methoxyphenyl)methyl]imidazol-3-ium |
| SMILES | COc1ccc(C[n+]2ccn(C(C)(C)C)c2)cc1 |
| InChI | InChI=1S/C15H21N2O/c1-15(2,3)17-10-9-16(12-17)11-13-5-7-14(18-4)8-6-13/h5-10,12H,11H2,1-4H3/q+1 |
| InChIKey | GAQPSRSOGGISRI-UHFFFAOYSA-N |
| XLogP | 2.59 |
| TPSA | 18.04 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 245.35 |
| LogP ≤ 5 | 2.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|