About 1-tert-butyl-3-(9,9-dimethyldecyl)imidazol-3-ium
1-tert-butyl-3-(9,9-dimethyldecyl)imidazol-3-ium (PubChem CID 142459296) has the molecular formula C19H37N2+
and a molecular weight of 293.52 g/mol. Its IUPAC name is 1-tert-butyl-3-(9,9-dimethyldecyl)imidazol-3-ium.
Molecular Properties
| Compound Name | 1-tert-butyl-3-(9,9-dimethyldecyl)imidazol-3-ium |
| PubChem CID | 142459296 |
| Molecular Formula | C19H37N2+ |
| Molecular Weight | 293.52 g/mol |
| Exact Mass | 293.30 |
| IUPAC Name | 1-tert-butyl-3-(9,9-dimethyldecyl)imidazol-3-ium |
| SMILES | CC(C)(C)CCCCCCCC[n+]1ccn(C(C)(C)C)c1 |
| InChI | InChI=1S/C19H37N2/c1-18(2,3)13-11-9-7-8-10-12-14-20-15-16-21(17-20)19(4,5)6/h15-17H,7-14H2,1-6H3/q+1 |
| InChIKey | KQYSJUIVXVHEOT-UHFFFAOYSA-N |
| XLogP | 5.31 |
| TPSA | 8.81 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 293.52 |
| LogP ≤ 5 | 5.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|
Analyze 1-tert-butyl-3-(9,9-dimethyldecyl)imidazol-3-ium with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-tert-butyl-3-(9,9-dimethyldecyl)imidazol-3-ium?
The IUPAC name of 1-tert-butyl-3-(9,9-dimethyldecyl)imidazol-3-ium (CID 142459296) is 1-tert-butyl-3-(9,9-dimethyldecyl)imidazol-3-ium.
What is the SMILES notation for 1-tert-butyl-3-(9,9-dimethyldecyl)imidazol-3-ium?
The canonical SMILES for 1-tert-butyl-3-(9,9-dimethyldecyl)imidazol-3-ium is CC(C)(C)CCCCCCCC[n+]1ccn(C(C)(C)C)c1.
What is the InChIKey of 1-tert-butyl-3-(9,9-dimethyldecyl)imidazol-3-ium?
The InChIKey is KQYSJUIVXVHEOT-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H37N2/c1-18(2,3)13-11-9-7-8-10-12-14-20-15-16-21(17-20)19(4,5)6/h15-17H,7-14H2,1-6H3/q+1.
What are the key properties of 1-tert-butyl-3-(9,9-dimethyldecyl)imidazol-3-ium?
1-tert-butyl-3-(9,9-dimethyldecyl)imidazol-3-ium has a molecular weight of 293.52 g/mol, XLogP of 5.31, 8 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 1-tert-butyl-3-(9,9-dimethyldecyl)imidazol-3-ium is sourced from PubChem (CID 142459296), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).