C12H24N3+ — CID 101460786
3-(3-tert-butylimidazol-1-ium-1-yl)-N,N-dimethylpropan-1-amine (PubChem CID 101460786) has the molecular formula C12H24N3+ and a molecular weight of 210.34 g/mol. Its IUPAC name is 3-(3-tert-butylimidazol-1-ium-1-yl)-N,N-dimethylpropan-1-amine.
| Compound Name | 3-(3-tert-butylimidazol-1-ium-1-yl)-N,N-dimethylpropan-1-amine |
|---|---|
| PubChem CID | 101460786 |
| Molecular Formula | C12H24N3+ |
| Molecular Weight | 210.34 g/mol |
| Exact Mass | 210.20 |
| IUPAC Name | 3-(3-tert-butylimidazol-1-ium-1-yl)-N,N-dimethylpropan-1-amine |
| SMILES | CN(C)CCC[n+]1ccn(C(C)(C)C)c1 |
| InChI | InChI=1S/C12H24N3/c1-12(2,3)15-10-9-14(11-15)8-6-7-13(4)5/h9-11H,6-8H2,1-5H3/q+1 |
| InChIKey | CMCDJIKLBJSHSJ-UHFFFAOYSA-N |
| XLogP | 1.48 |
| TPSA | 12.05 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 210.34 |
| LogP ≤ 5 | 1.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|