C13H25N2+ — CID 149387025
1-ethyl-3-(2,4,4-trimethylpentan-2-yl)imidazol-1-ium (PubChem CID 149387025) has the molecular formula C13H25N2+ and a molecular weight of 209.36 g/mol. Its IUPAC name is 1-ethyl-3-(2,4,4-trimethylpentan-2-yl)imidazol-1-ium.
| Compound Name | 1-ethyl-3-(2,4,4-trimethylpentan-2-yl)imidazol-1-ium |
|---|---|
| PubChem CID | 149387025 |
| Molecular Formula | C13H25N2+ |
| Molecular Weight | 209.36 g/mol |
| Exact Mass | 209.20 |
| IUPAC Name | 1-ethyl-3-(2,4,4-trimethylpentan-2-yl)imidazol-1-ium |
| SMILES | CC[n+]1ccn(C(C)(C)CC(C)(C)C)c1 |
| InChI | InChI=1S/C13H25N2/c1-7-14-8-9-15(11-14)13(5,6)10-12(2,3)4/h8-9,11H,7,10H2,1-6H3/q+1 |
| InChIKey | PKPGDRFQYBOUHL-UHFFFAOYSA-N |
| XLogP | 2.97 |
| TPSA | 8.81 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 209.36 |
| LogP ≤ 5 | 2.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|