C7H8F5N2+ — CID 87098448
1-ethyl-3-(1,1,2,2,2-pentafluoroethyl)imidazol-1-ium (PubChem CID 87098448) has the molecular formula C7H8F5N2+ and a molecular weight of 215.15 g/mol. Its IUPAC name is 1-ethyl-3-(1,1,2,2,2-pentafluoroethyl)imidazol-1-ium.
| Compound Name | 1-ethyl-3-(1,1,2,2,2-pentafluoroethyl)imidazol-1-ium |
|---|---|
| PubChem CID | 87098448 |
| Molecular Formula | C7H8F5N2+ |
| Molecular Weight | 215.15 g/mol |
| Exact Mass | 215.06 |
| IUPAC Name | 1-ethyl-3-(1,1,2,2,2-pentafluoroethyl)imidazol-1-ium |
| SMILES | CC[n+]1ccn(C(F)(F)C(F)(F)F)c1 |
| InChI | InChI=1S/C7H8F5N2/c1-2-13-3-4-14(5-13)7(11,12)6(8,9)10/h3-5H,2H2,1H3/q+1 |
| InChIKey | BVEZNMWOVYFTFU-UHFFFAOYSA-N |
| XLogP | 1.91 |
| TPSA | 8.81 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 215.15 |
| LogP ≤ 5 | 1.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|