C26H42N2O2 — CID 156821752
1-benzyl-3-(2,4,4-trimethylpentan-2-yl)imidazol-1-ium;2-ethylhexanoate (PubChem CID 156821752) has the molecular formula C26H42N2O2 and a molecular weight of 414.63 g/mol. Its IUPAC name is 1-benzyl-3-(2,4,4-trimethylpentan-2-yl)imidazol-1-ium;2-ethylhexanoate.
| Compound Name | 1-benzyl-3-(2,4,4-trimethylpentan-2-yl)imidazol-1-ium;2-ethylhexanoate |
|---|---|
| PubChem CID | 156821752 |
| Molecular Formula | C26H42N2O2 |
| Molecular Weight | 414.63 g/mol |
| Exact Mass | 414.32 |
| IUPAC Name | 1-benzyl-3-(2,4,4-trimethylpentan-2-yl)imidazol-1-ium;2-ethylhexanoate |
| SMILES | CC(C)(C)CC(C)(C)n1cc[n+](Cc2ccccc2)c1.CCCCC(CC)C(=O)[O-] |
| InChI | InChI=1S/C18H27N2.C8H16O2/c1-17(2,3)14-18(4,5)20-12-11-19(15-20)13-16-9-7-6-8-10-16;1-3-5-6-7(4-2)8(9)10/h6-12,15H,13-14H2,1-5H3;7H,3-6H2,1-2H3,(H,9,10)/q+1;/p-1 |
| InChIKey | WGHJNBQAWONXIN-UHFFFAOYSA-M |
| XLogP | 4.95 |
| TPSA | 48.94 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.63 |
| LogP ≤ 5 | 4.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|