C17H25N2+ — CID 87809088
1-benzyl-3-heptylimidazol-1-ium (PubChem CID 87809088) has the molecular formula C17H25N2+ and a molecular weight of 257.40 g/mol. Its IUPAC name is 1-benzyl-3-heptylimidazol-1-ium.
| Compound Name | 1-benzyl-3-heptylimidazol-1-ium |
|---|---|
| PubChem CID | 87809088 |
| Molecular Formula | C17H25N2+ |
| Molecular Weight | 257.40 g/mol |
| Exact Mass | 257.20 |
| IUPAC Name | 1-benzyl-3-heptylimidazol-1-ium |
| SMILES | CCCCCCCn1cc[n+](Cc2ccccc2)c1 |
| InChI | InChI=1S/C17H25N2/c1-2-3-4-5-9-12-18-13-14-19(16-18)15-17-10-7-6-8-11-17/h6-8,10-11,13-14,16H,2-5,9,12,15H2,1H3/q+1 |
| InChIKey | XYPHTNLNVDRILD-UHFFFAOYSA-N |
| XLogP | 3.79 |
| TPSA | 8.81 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 257.40 |
| LogP ≤ 5 | 3.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|