C44H68N6+4 — CID 162703003
1,4-bis[[4-[(3-octylimidazol-1-ium-1-yl)methyl]phenyl]methyl]-1,4-diazoniabicyclo[2.2.2]octane (PubChem CID 162703003) has the molecular formula C44H68N6+4 and a molecular weight of 681.07 g/mol. Its IUPAC name is 1,4-bis[[4-[(3-octylimidazol-1-ium-1-yl)methyl]phenyl]methyl]-1,4-diazoniabicyclo[2.2.2]octane.
| Compound Name | 1,4-bis[[4-[(3-octylimidazol-1-ium-1-yl)methyl]phenyl]methyl]-1,4-diazoniabicyclo[2.2.2]octane |
|---|---|
| PubChem CID | 162703003 |
| Molecular Formula | C44H68N6+4 |
| Molecular Weight | 681.07 g/mol |
| Exact Mass | 680.55 |
| IUPAC Name | 1,4-bis[[4-[(3-octylimidazol-1-ium-1-yl)methyl]phenyl]methyl]-1,4-diazoniabicyclo[2.2.2]octane |
| SMILES | CCCCCCCCn1cc[n+](Cc2ccc(C[N+]34CC[N+](Cc5ccc(C[n+]6ccn(CCCCCCCC)c6)cc5)(CC3)CC4)cc2)c1 |
| InChI | InChI=1S/C44H68N6/c1-3-5-7-9-11-13-23-45-25-27-47(39-45)35-41-15-19-43(20-16-41)37-49-29-32-50(33-30-49,34-31-49)38-44-21-17-42(18-22-44)36-48-28-26-46(40-48)24-14-12-10-8-6-4-2/h15-22,25-28,39-40H,3-14,23-24,29-38H2,1-2H3/q+4 |
| InChIKey | OWZRBORYLVWHJG-UHFFFAOYSA-N |
| XLogP | 8.04 |
| TPSA | 17.62 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 22 |
| Heavy Atoms | 50 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 681.07 |
| LogP ≤ 5 | 8.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|