C23H41N2Si2+ — CID 53325594
trimethyl-[5-[3-[[4-(2-trimethylsilylethyl)phenyl]methyl]imidazol-3-ium-1-yl]pentyl]silane (PubChem CID 53325594) has the molecular formula C23H41N2Si2+ and a molecular weight of 401.77 g/mol. Its IUPAC name is trimethyl-[5-[3-[[4-(2-trimethylsilylethyl)phenyl]methyl]imidazol-3-ium-1-yl]pentyl]silane.
| Compound Name | trimethyl-[5-[3-[[4-(2-trimethylsilylethyl)phenyl]methyl]imidazol-3-ium-1-yl]pentyl]silane |
|---|---|
| PubChem CID | 53325594 |
| Molecular Formula | C23H41N2Si2+ |
| Molecular Weight | 401.77 g/mol |
| Exact Mass | 401.28 |
| IUPAC Name | trimethyl-[5-[3-[[4-(2-trimethylsilylethyl)phenyl]methyl]imidazol-3-ium-1-yl]pentyl]silane |
| SMILES | C[Si](C)(C)CCCCCn1cc[n+](Cc2ccc(CC[Si](C)(C)C)cc2)c1 |
| InChI | InChI=1S/C23H41N2Si2/c1-26(2,3)18-9-7-8-15-24-16-17-25(21-24)20-23-12-10-22(11-13-23)14-19-27(4,5)6/h10-13,16-17,21H,7-9,14-15,18-20H2,1-6H3/q+1 |
| InChIKey | PTDBLFOYXJMKHG-UHFFFAOYSA-N |
| XLogP | 6.21 |
| TPSA | 8.81 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.77 |
| LogP ≤ 5 | 6.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|