C13H17N2+ — CID 87808190
1-benzyl-3-propylimidazol-1-ium (PubChem CID 87808190) has the molecular formula C13H17N2+ and a molecular weight of 201.29 g/mol. Its IUPAC name is 1-benzyl-3-propylimidazol-1-ium.
| Compound Name | 1-benzyl-3-propylimidazol-1-ium |
|---|---|
| PubChem CID | 87808190 |
| Molecular Formula | C13H17N2+ |
| Molecular Weight | 201.29 g/mol |
| Exact Mass | 201.14 |
| IUPAC Name | 1-benzyl-3-propylimidazol-1-ium |
| SMILES | CCCn1cc[n+](Cc2ccccc2)c1 |
| InChI | InChI=1S/C13H17N2/c1-2-8-14-9-10-15(12-14)11-13-6-4-3-5-7-13/h3-7,9-10,12H,2,8,11H2,1H3/q+1 |
| InChIKey | HSBHFGQRRHNDTI-UHFFFAOYSA-N |
| XLogP | 2.23 |
| TPSA | 8.81 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 201.29 |
| LogP ≤ 5 | 2.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|