C30H36N4+2 — CID 102468298
1-butyl-3-[[10-[(3-butylimidazol-1-ium-1-yl)methyl]anthracen-9-yl]methyl]imidazol-3-ium (PubChem CID 102468298) has the molecular formula C30H36N4+2 and a molecular weight of 452.65 g/mol. Its IUPAC name is 1-butyl-3-[[10-[(3-butylimidazol-1-ium-1-yl)methyl]anthracen-9-yl]methyl]imidazol-3-ium.
| Compound Name | 1-butyl-3-[[10-[(3-butylimidazol-1-ium-1-yl)methyl]anthracen-9-yl]methyl]imidazol-3-ium |
|---|---|
| PubChem CID | 102468298 |
| Molecular Formula | C30H36N4+2 |
| Molecular Weight | 452.65 g/mol |
| Exact Mass | 452.29 |
| IUPAC Name | 1-butyl-3-[[10-[(3-butylimidazol-1-ium-1-yl)methyl]anthracen-9-yl]methyl]imidazol-3-ium |
| SMILES | CCCCn1cc[n+](Cc2c3ccccc3c(C[n+]3ccn(CCCC)c3)c3ccccc23)c1 |
| InChI | InChI=1S/C30H36N4/c1-3-5-15-31-17-19-33(23-31)21-29-25-11-7-9-13-27(25)30(28-14-10-8-12-26(28)29)22-34-20-18-32(24-34)16-6-4-2/h7-14,17-20,23-24H,3-6,15-16,21-22H2,1-2H3/q+2 |
| InChIKey | SKHBACLQAGDLSD-UHFFFAOYSA-N |
| XLogP | 5.87 |
| TPSA | 17.62 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 452.65 |
| LogP ≤ 5 | 5.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|