C44H44I2N4O3 — CID 11607633
1-(anthracen-9-ylmethyl)-3-[2-[2-[2-[2-[3-(anthracen-9-ylmethyl)imidazol-3-ium-1-yl]ethoxy]ethoxy]ethoxy]ethyl]imidazol-1-ium diiodide (PubChem CID 11607633) has the molecular formula C44H44I2N4O3 and a molecular weight of 930.67 g/mol. Its IUPAC name is 1-(anthracen-9-ylmethyl)-3-[2-[2-[2-[2-[3-(anthracen-9-ylmethyl)imidazol-3-ium-1-yl]ethoxy]ethoxy]ethoxy]ethyl]imidazol-1-ium diiodide.
| Compound Name | 1-(anthracen-9-ylmethyl)-3-[2-[2-[2-[2-[3-(anthracen-9-ylmethyl)imidazol-3-ium-1-yl]ethoxy]ethoxy]ethoxy]ethyl]imidazol-1-ium diiodide |
|---|---|
| PubChem CID | 11607633 |
| Molecular Formula | C44H44I2N4O3 |
| Molecular Weight | 930.67 g/mol |
| Exact Mass | 930.15 |
| IUPAC Name | 1-(anthracen-9-ylmethyl)-3-[2-[2-[2-[2-[3-(anthracen-9-ylmethyl)imidazol-3-ium-1-yl]ethoxy]ethoxy]ethoxy]ethyl]imidazol-1-ium diiodide |
| SMILES | [I-].[I-].c1ccc2c(C[n+]3ccn(CCOCCOCCOCCn4cc[n+](Cc5c6ccccc6cc6ccccc56)c4)c3)c3ccccc3cc2c1 |
| InChI | InChI=1S/C44H44N4O3.2HI/c1-5-13-39-35(9-1)29-36-10-2-6-14-40(36)43(39)31-47-19-17-45(33-47)21-23-49-25-27-51-28-26-50-24-22-46-18-20-48(34-46)32-44-41-15-7-3-11-37(41)30-38-12-4-8-16-42(38)44;;/h1-20,29-30,33-34H,21-28,31-32H2;2*1H/q+2;;/p-2 |
| InChIKey | DNDRETBVSLSKAE-UHFFFAOYSA-L |
| XLogP | 1.33 |
| TPSA | 45.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 53 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 930.67 |
| LogP ≤ 5 | 1.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|