C34H30N6+2 — CID 102482449
2-[[3-[[10-[[3-(pyridin-2-ylmethyl)imidazol-1-ium-1-yl]methyl]anthracen-9-yl]methyl]imidazol-3-ium-1-yl]methyl]pyridine (PubChem CID 102482449) has the molecular formula C34H30N6+2 and a molecular weight of 522.66 g/mol. Its IUPAC name is 2-[[3-[[10-[[3-(pyridin-2-ylmethyl)imidazol-1-ium-1-yl]methyl]anthracen-9-yl]methyl]imidazol-3-ium-1-yl]methyl]pyridine.
| Compound Name | 2-[[3-[[10-[[3-(pyridin-2-ylmethyl)imidazol-1-ium-1-yl]methyl]anthracen-9-yl]methyl]imidazol-3-ium-1-yl]methyl]pyridine |
|---|---|
| PubChem CID | 102482449 |
| Molecular Formula | C34H30N6+2 |
| Molecular Weight | 522.66 g/mol |
| Exact Mass | 522.25 |
| IUPAC Name | 2-[[3-[[10-[[3-(pyridin-2-ylmethyl)imidazol-1-ium-1-yl]methyl]anthracen-9-yl]methyl]imidazol-3-ium-1-yl]methyl]pyridine |
| SMILES | c1ccc(Cn2cc[n+](Cc3c4ccccc4c(C[n+]4ccn(Cc5ccccn5)c4)c4ccccc34)c2)nc1 |
| InChI | InChI=1S/C34H30N6/c1-2-12-30-29(11-1)33(23-39-19-17-37(25-39)21-27-9-5-7-15-35-27)31-13-3-4-14-32(31)34(30)24-40-20-18-38(26-40)22-28-10-6-8-16-36-28/h1-20,25-26H,21-24H2/q+2 |
| InChIKey | JTANZRWCOQNWJK-UHFFFAOYSA-N |
| XLogP | 5.15 |
| TPSA | 43.40 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 522.66 |
| LogP ≤ 5 | 5.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|