C25H25N7+2 — CID 102320907
2,6-bis[[3-(pyridin-2-ylmethyl)imidazol-1-ium-1-yl]methyl]pyridine (PubChem CID 102320907) has the molecular formula C25H25N7+2 and a molecular weight of 423.52 g/mol. Its IUPAC name is 2,6-bis[[3-(pyridin-2-ylmethyl)imidazol-1-ium-1-yl]methyl]pyridine.
| Compound Name | 2,6-bis[[3-(pyridin-2-ylmethyl)imidazol-1-ium-1-yl]methyl]pyridine |
|---|---|
| PubChem CID | 102320907 |
| Molecular Formula | C25H25N7+2 |
| Molecular Weight | 423.52 g/mol |
| Exact Mass | 423.22 |
| IUPAC Name | 2,6-bis[[3-(pyridin-2-ylmethyl)imidazol-1-ium-1-yl]methyl]pyridine |
| SMILES | c1ccc(Cn2cc[n+](Cc3cccc(C[n+]4ccn(Cc5ccccn5)c4)n3)c2)nc1 |
| InChI | InChI=1S/C25H25N7/c1-3-10-26-22(6-1)16-29-12-14-31(20-29)18-24-8-5-9-25(28-24)19-32-15-13-30(21-32)17-23-7-2-4-11-27-23/h1-15,20-21H,16-19H2/q+2 |
| InChIKey | OMTBVZAWRSIMPC-UHFFFAOYSA-N |
| XLogP | 2.24 |
| TPSA | 56.29 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 423.52 |
| LogP ≤ 5 | 2.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|