C9H15N6+ — CID 66560142
5-[(3-butylimidazol-1-ium-1-yl)methyl]-2H-tetrazole (PubChem CID 66560142) has the molecular formula C9H15N6+ and a molecular weight of 207.26 g/mol. Its IUPAC name is 5-[(3-butylimidazol-1-ium-1-yl)methyl]-2H-tetrazole.
| Compound Name | 5-[(3-butylimidazol-1-ium-1-yl)methyl]-2H-tetrazole |
|---|---|
| PubChem CID | 66560142 |
| Molecular Formula | C9H15N6+ |
| Molecular Weight | 207.26 g/mol |
| Exact Mass | 207.14 |
| IUPAC Name | 5-[(3-butylimidazol-1-ium-1-yl)methyl]-2H-tetrazole |
| SMILES | CCCCn1cc[n+](Cc2nn[nH]n2)c1 |
| InChI | InChI=1S/C9H15N6/c1-2-3-4-14-5-6-15(8-14)7-9-10-12-13-11-9/h5-6,8H,2-4,7H2,1H3,(H,10,11,12,13)/q+1 |
| InChIKey | QJMWRYGLKVACCH-UHFFFAOYSA-N |
| XLogP | 0.14 |
| TPSA | 63.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 207.26 |
| LogP ≤ 5 | 0.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|