C46H72Br2N4O2 — CID 175686330
1-[(4-decoxyphenyl)methyl]-3-[6-[3-[(4-decoxyphenyl)methyl]imidazol-3-ium-1-yl]hexyl]imidazol-1-ium dibromide (PubChem CID 175686330) has the molecular formula C46H72Br2N4O2 and a molecular weight of 872.92 g/mol. Its IUPAC name is 1-[(4-decoxyphenyl)methyl]-3-[6-[3-[(4-decoxyphenyl)methyl]imidazol-3-ium-1-yl]hexyl]imidazol-1-ium dibromide.
| Compound Name | 1-[(4-decoxyphenyl)methyl]-3-[6-[3-[(4-decoxyphenyl)methyl]imidazol-3-ium-1-yl]hexyl]imidazol-1-ium dibromide |
|---|---|
| PubChem CID | 175686330 |
| Molecular Formula | C46H72Br2N4O2 |
| Molecular Weight | 872.92 g/mol |
| Exact Mass | 870.40 |
| IUPAC Name | 1-[(4-decoxyphenyl)methyl]-3-[6-[3-[(4-decoxyphenyl)methyl]imidazol-3-ium-1-yl]hexyl]imidazol-1-ium dibromide |
| SMILES | CCCCCCCCCCOc1ccc(C[n+]2ccn(CCCCCCn3cc[n+](Cc4ccc(OCCCCCCCCCC)cc4)c3)c2)cc1.[Br-].[Br-] |
| InChI | InChI=1S/C46H72N4O2.2BrH/c1-3-5-7-9-11-13-17-21-37-51-45-27-23-43(24-28-45)39-49-35-33-47(41-49)31-19-15-16-20-32-48-34-36-50(42-48)40-44-25-29-46(30-26-44)52-38-22-18-14-12-10-8-6-4-2;;/h23-30,33-36,41-42H,3-22,31-32,37-40H2,1-2H3;2*1H/q+2;;/p-2 |
| InChIKey | ZFGYXBQRZKQFQD-UHFFFAOYSA-L |
| XLogP | 5.27 |
| TPSA | 36.08 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 31 |
| Heavy Atoms | 54 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 872.92 |
| LogP ≤ 5 | 5.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|