C30H43N4O+ — CID 122205814
(4-methylphenyl)-[4-[6-(3-octylimidazol-3-ium-1-yl)hexoxy]phenyl]diazene (PubChem CID 122205814) has the molecular formula C30H43N4O+ and a molecular weight of 475.70 g/mol. Its IUPAC name is (4-methylphenyl)-[4-[6-(3-octylimidazol-3-ium-1-yl)hexoxy]phenyl]diazene.
| Compound Name | (4-methylphenyl)-[4-[6-(3-octylimidazol-3-ium-1-yl)hexoxy]phenyl]diazene |
|---|---|
| PubChem CID | 122205814 |
| Molecular Formula | C30H43N4O+ |
| Molecular Weight | 475.70 g/mol |
| Exact Mass | 475.34 |
| IUPAC Name | (4-methylphenyl)-[4-[6-(3-octylimidazol-3-ium-1-yl)hexoxy]phenyl]diazene |
| SMILES | CCCCCCCC[n+]1ccn(CCCCCCOc2ccc(/N=N/c3ccc(C)cc3)cc2)c1 |
| InChI | InChI=1S/C30H43N4O/c1-3-4-5-6-7-10-21-33-23-24-34(26-33)22-11-8-9-12-25-35-30-19-17-29(18-20-30)32-31-28-15-13-27(2)14-16-28/h13-20,23-24,26H,3-12,21-22,25H2,1-2H3/q+1/b32-31+ |
| InChIKey | DONZVKMSZKFBSB-QNEJGDQOSA-N |
| XLogP | 8.50 |
| TPSA | 42.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 475.70 |
| LogP ≤ 5 | 8.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|