C32H47N4O+ — CID 122205815
[4-[6-(3-decylimidazol-3-ium-1-yl)hexoxy]phenyl]-(4-methylphenyl)diazene (PubChem CID 122205815) has the molecular formula C32H47N4O+ and a molecular weight of 503.76 g/mol. Its IUPAC name is [4-[6-(3-decylimidazol-3-ium-1-yl)hexoxy]phenyl]-(4-methylphenyl)diazene.
| Compound Name | [4-[6-(3-decylimidazol-3-ium-1-yl)hexoxy]phenyl]-(4-methylphenyl)diazene |
|---|---|
| PubChem CID | 122205815 |
| Molecular Formula | C32H47N4O+ |
| Molecular Weight | 503.76 g/mol |
| Exact Mass | 503.37 |
| IUPAC Name | [4-[6-(3-decylimidazol-3-ium-1-yl)hexoxy]phenyl]-(4-methylphenyl)diazene |
| SMILES | CCCCCCCCCC[n+]1ccn(CCCCCCOc2ccc(/N=N/c3ccc(C)cc3)cc2)c1 |
| InChI | InChI=1S/C32H47N4O/c1-3-4-5-6-7-8-9-12-23-35-25-26-36(28-35)24-13-10-11-14-27-37-32-21-19-31(20-22-32)34-33-30-17-15-29(2)16-18-30/h15-22,25-26,28H,3-14,23-24,27H2,1-2H3/q+1/b34-33+ |
| InChIKey | BBLIXHPHNGFEHV-JEIPZWNWSA-N |
| XLogP | 9.28 |
| TPSA | 42.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 19 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 503.76 |
| LogP ≤ 5 | 9.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|