C28H27ClN2O3 — CID 10005142
2-hydroxy-N-[[1-[(4-methoxyphenyl)methyl]pyridin-1-ium-4-yl]methyl]-2,2-diphenylacetamide chloride (PubChem CID 10005142) has the molecular formula C28H27ClN2O3 and a molecular weight of 474.99 g/mol. Its IUPAC name is 2-hydroxy-N-[[1-[(4-methoxyphenyl)methyl]pyridin-1-ium-4-yl]methyl]-2,2-diphenylacetamide chloride.
| Compound Name | 2-hydroxy-N-[[1-[(4-methoxyphenyl)methyl]pyridin-1-ium-4-yl]methyl]-2,2-diphenylacetamide chloride |
|---|---|
| PubChem CID | 10005142 |
| Molecular Formula | C28H27ClN2O3 |
| Molecular Weight | 474.99 g/mol |
| Exact Mass | 474.17 |
| IUPAC Name | 2-hydroxy-N-[[1-[(4-methoxyphenyl)methyl]pyridin-1-ium-4-yl]methyl]-2,2-diphenylacetamide chloride |
| SMILES | COc1ccc(C[n+]2ccc(CNC(=O)C(O)(c3ccccc3)c3ccccc3)cc2)cc1.[Cl-] |
| InChI | InChI=1S/C28H26N2O3.ClH/c1-33-26-14-12-23(13-15-26)21-30-18-16-22(17-19-30)20-29-27(31)28(32,24-8-4-2-5-9-24)25-10-6-3-7-11-25;/h2-19,32H,20-21H2,1H3;1H |
| InChIKey | CKMNNEISGQTLML-UHFFFAOYSA-N |
| XLogP | 0.59 |
| TPSA | 62.44 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 474.99 |
| LogP ≤ 5 | 0.59 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|