C17H22BrNO — CID 169077655
3-tert-butyl-1-[(4-methoxyphenyl)methyl]pyridin-1-ium bromide (PubChem CID 169077655) has the molecular formula C17H22BrNO and a molecular weight of 336.27 g/mol. Its IUPAC name is 3-tert-butyl-1-[(4-methoxyphenyl)methyl]pyridin-1-ium bromide.
| Compound Name | 3-tert-butyl-1-[(4-methoxyphenyl)methyl]pyridin-1-ium bromide |
|---|---|
| PubChem CID | 169077655 |
| Molecular Formula | C17H22BrNO |
| Molecular Weight | 336.27 g/mol |
| Exact Mass | 335.09 |
| IUPAC Name | 3-tert-butyl-1-[(4-methoxyphenyl)methyl]pyridin-1-ium bromide |
| SMILES | COc1ccc(C[n+]2cccc(C(C)(C)C)c2)cc1.[Br-] |
| InChI | InChI=1S/C17H22NO.BrH/c1-17(2,3)15-6-5-11-18(13-15)12-14-7-9-16(19-4)10-8-14;/h5-11,13H,12H2,1-4H3;1H/q+1;/p-1 |
| InChIKey | DCJKCKVESSRSQF-UHFFFAOYSA-M |
| XLogP | 0.33 |
| TPSA | 13.11 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.27 |
| LogP ≤ 5 | 0.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|