C46H47N3OPt-2 — CID 155614509
4-tert-butyl-2-(2,7-ditert-butyl-9-phenylfluoren-9-yl)-6-[3-(3-methyl-2H-imidazol-3-ium-2-id-1-yl)benzene-2-id-1-yl]oxypyridine;platinum (PubChem CID 155614509) has the molecular formula C46H47N3OPt-2 and a molecular weight of 852.98 g/mol. Its IUPAC name is 4-tert-butyl-2-(2,7-ditert-butyl-9-phenylfluoren-9-yl)-6-[3-(3-methyl-2H-imidazol-3-ium-2-id-1-yl)benzene-2-id-1-yl]oxypyridine;platinum.
| Compound Name | 4-tert-butyl-2-(2,7-ditert-butyl-9-phenylfluoren-9-yl)-6-[3-(3-methyl-2H-imidazol-3-ium-2-id-1-yl)benzene-2-id-1-yl]oxypyridine;platinum |
|---|---|
| PubChem CID | 155614509 |
| Molecular Formula | C46H47N3OPt-2 |
| Molecular Weight | 852.98 g/mol |
| Exact Mass | 852.34 |
| IUPAC Name | 4-tert-butyl-2-(2,7-ditert-butyl-9-phenylfluoren-9-yl)-6-[3-(3-methyl-2H-imidazol-3-ium-2-id-1-yl)benzene-2-id-1-yl]oxypyridine;platinum |
| SMILES | C[n+]1[c-]n(-c2[c-]c(Oc3cc(C(C)(C)C)cc(C4(c5[c-]cccc5)c5cc(C(C)(C)C)ccc5-c5ccc(C(C)(C)C)cc54)n3)ccc2)cc1.[Pt] |
| InChI | InChI=1S/C46H47N3O.Pt/c1-43(2,3)32-19-21-37-38-22-20-33(44(4,5)6)26-40(38)46(39(37)25-32,31-15-12-11-13-16-31)41-27-34(45(7,8)9)28-42(47-41)50-36-18-14-17-35(29-36)49-24-23-48(10)30-49;/h11-15,17-28H,1-10H3;/q-2; |
| InChIKey | IQOCNGCUTQPJLP-UHFFFAOYSA-N |
| XLogP | 10.14 |
| TPSA | 30.93 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 51 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 852.98 |
| LogP ≤ 5 | 10.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|