C37H29N5Pt-2 — CID 165164205
2-tert-butyl-10-[3-(3-methyl-2H-imidazol-3-ium-2-id-1-yl)benzene-2-id-1-yl]-14-phenyl-10,12,14-triazapentacyclo[11.7.0.03,11.04,9.015,20]icosa-1,3(11),4,6,8,12,15,17,19-nonaene;platinum (PubChem CID 165164205) has the molecular formula C37H29N5Pt-2 and a molecular weight of 738.75 g/mol. Its IUPAC name is 2-tert-butyl-10-[3-(3-methyl-2H-imidazol-3-ium-2-id-1-yl)benzene-2-id-1-yl]-14-phenyl-10,12,14-triazapentacyclo[11.7.0.03,11.04,9.015,20]icosa-1,3(11),4,6,8,12,15,17,19-nonaene;platinum.
| Compound Name | 2-tert-butyl-10-[3-(3-methyl-2H-imidazol-3-ium-2-id-1-yl)benzene-2-id-1-yl]-14-phenyl-10,12,14-triazapentacyclo[11.7.0.03,11.04,9.015,20]icosa-1,3(11),4,6,8,12,15,17,19-nonaene;platinum |
|---|---|
| PubChem CID | 165164205 |
| Molecular Formula | C37H29N5Pt-2 |
| Molecular Weight | 738.75 g/mol |
| Exact Mass | 738.21 |
| IUPAC Name | 2-tert-butyl-10-[3-(3-methyl-2H-imidazol-3-ium-2-id-1-yl)benzene-2-id-1-yl]-14-phenyl-10,12,14-triazapentacyclo[11.7.0.03,11.04,9.015,20]icosa-1,3(11),4,6,8,12,15,17,19-nonaene;platinum |
| SMILES | C[n+]1[c-]n(-c2[c-]c(-n3c4ccccc4c4c(C(C)(C)C)c5c6ccccc6n(-c6[c-]cccc6)c5nc43)ccc2)cc1.[Pt] |
| InChI | InChI=1S/C37H29N5.Pt/c1-37(2,3)34-32-28-17-8-10-19-30(28)41(25-13-6-5-7-14-25)35(32)38-36-33(34)29-18-9-11-20-31(29)42(36)27-16-12-15-26(23-27)40-22-21-39(4)24-40;/h5-13,15-22H,1-4H3;/q-2; |
| InChIKey | RPYYMWHXSLRFIL-UHFFFAOYSA-N |
| XLogP | 7.59 |
| TPSA | 31.56 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 738.75 |
| LogP ≤ 5 | 7.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|