C43H29N3OPt — CID 165164093
2-(4-methoxyphenyl)-10-[3-(2-methylphenyl)benzene-2-id-1-yl]-14-phenyl-10,12,14-triazapentacyclo[11.7.0.03,11.04,9.015,20]icosa-1,3(11),4,6,8,12,15,17,19-nonaene;platinum(2+) (PubChem CID 165164093) has the molecular formula C43H29N3OPt and a molecular weight of 798.80 g/mol. Its IUPAC name is 2-(4-methoxyphenyl)-10-[3-(2-methylphenyl)benzene-2-id-1-yl]-14-phenyl-10,12,14-triazapentacyclo[11.7.0.03,11.04,9.015,20]icosa-1,3(11),4,6,8,12,15,17,19-nonaene;platinum(2+).
| Compound Name | 2-(4-methoxyphenyl)-10-[3-(2-methylphenyl)benzene-2-id-1-yl]-14-phenyl-10,12,14-triazapentacyclo[11.7.0.03,11.04,9.015,20]icosa-1,3(11),4,6,8,12,15,17,19-nonaene;platinum(2+) |
|---|---|
| PubChem CID | 165164093 |
| Molecular Formula | C43H29N3OPt |
| Molecular Weight | 798.80 g/mol |
| Exact Mass | 798.20 |
| IUPAC Name | 2-(4-methoxyphenyl)-10-[3-(2-methylphenyl)benzene-2-id-1-yl]-14-phenyl-10,12,14-triazapentacyclo[11.7.0.03,11.04,9.015,20]icosa-1,3(11),4,6,8,12,15,17,19-nonaene;platinum(2+) |
| SMILES | COc1ccc(-c2c3c4ccccc4n(-c4[c-]cccc4)c3nc3c2c2ccccc2n3-c2[c-]c(-c3ccccc3C)ccc2)cc1.[Pt+2] |
| InChI | InChI=1S/C43H29N3O.Pt/c1-28-13-6-7-18-34(28)30-14-12-17-32(27-30)46-38-22-11-9-20-36(38)41-39(29-23-25-33(47-2)26-24-29)40-35-19-8-10-21-37(35)45(42(40)44-43(41)46)31-15-4-3-5-16-31;/h3-15,17-26H,1-2H3;/q-2;+2 |
| InChIKey | YZRAFUIPFCPLAC-UHFFFAOYSA-N |
| XLogP | 10.52 |
| TPSA | 31.98 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 798.80 |
| LogP ≤ 5 | 10.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|