C40H31N3Pt — CID 165164268
2-tert-butyl-10-[3-(2-methylphenyl)benzene-2-id-1-yl]-14-phenyl-10,12,14-triazapentacyclo[11.7.0.03,11.04,9.015,20]icosa-1,3(11),4,6,8,12,15,17,19-nonaene;platinum(2+) (PubChem CID 165164268) has the molecular formula C40H31N3Pt and a molecular weight of 748.79 g/mol. Its IUPAC name is 2-tert-butyl-10-[3-(2-methylphenyl)benzene-2-id-1-yl]-14-phenyl-10,12,14-triazapentacyclo[11.7.0.03,11.04,9.015,20]icosa-1,3(11),4,6,8,12,15,17,19-nonaene;platinum(2+).
| Compound Name | 2-tert-butyl-10-[3-(2-methylphenyl)benzene-2-id-1-yl]-14-phenyl-10,12,14-triazapentacyclo[11.7.0.03,11.04,9.015,20]icosa-1,3(11),4,6,8,12,15,17,19-nonaene;platinum(2+) |
|---|---|
| PubChem CID | 165164268 |
| Molecular Formula | C40H31N3Pt |
| Molecular Weight | 748.79 g/mol |
| Exact Mass | 748.22 |
| IUPAC Name | 2-tert-butyl-10-[3-(2-methylphenyl)benzene-2-id-1-yl]-14-phenyl-10,12,14-triazapentacyclo[11.7.0.03,11.04,9.015,20]icosa-1,3(11),4,6,8,12,15,17,19-nonaene;platinum(2+) |
| SMILES | Cc1ccccc1-c1[c-]c(-n2c3ccccc3c3c(C(C)(C)C)c4c5ccccc5n(-c5[c-]cccc5)c4nc32)ccc1.[Pt+2] |
| InChI | InChI=1S/C40H31N3.Pt/c1-26-15-8-9-20-30(26)27-16-14-19-29(25-27)43-34-24-13-11-22-32(34)36-37(40(2,3)4)35-31-21-10-12-23-33(31)42(38(35)41-39(36)43)28-17-6-5-7-18-28;/h5-17,19-24H,1-4H3;/q-2;+2 |
| InChIKey | NNLJQDNTRSLLLN-UHFFFAOYSA-N |
| XLogP | 10.15 |
| TPSA | 22.75 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 748.79 |
| LogP ≤ 5 | 10.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|