C49H30N3SiZn — CID 162457787
CID 162457787 (PubChem CID 162457787) has the molecular formula C49H30N3SiZn and a molecular weight of 754.28 g/mol.
| Compound Name | CID 162457787 |
|---|---|
| PubChem CID | 162457787 |
| Molecular Formula | C49H30N3SiZn |
| Molecular Weight | 754.28 g/mol |
| Exact Mass | 752.15 |
| IUPAC Name | — |
| SMILES | [Zn+2].[c-]1c(-c2cccc3ccc[c-]c23)cccc1-n1c2ccccc2c2cc3ccc4c5ccccc5n([Si](c5ccccc5)c5ccccc5)c4c3nc21 |
| InChI | InChI=1S/C49H30N3Si.Zn/c1-3-19-37(20-4-1)53(38-21-5-2-6-22-38)52-46-28-12-10-24-41(46)43-30-29-35-32-44-42-25-9-11-27-45(42)51(49(44)50-47(35)48(43)52)36-18-13-17-34(31-36)40-26-14-16-33-15-7-8-23-39(33)40;/h1-22,24-30,32H;/q-2;+2 |
| InChIKey | DQCVTAIZHZRVMR-UHFFFAOYSA-N |
| XLogP | 10.51 |
| TPSA | 22.75 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 54 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 754.28 |
| LogP ≤ 5 | 10.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|