C34H20N4Pt — CID 165164239
10-phenyl-14-(6-phenyl-2-pyridinyl)-10,12,14-triazapentacyclo[11.7.0.03,11.04,9.015,20]icosa-1(13),2,4,6,8,11,15,17,19-nonaene;platinum(2+) (PubChem CID 165164239) has the molecular formula C34H20N4Pt and a molecular weight of 679.64 g/mol. Its IUPAC name is 10-phenyl-14-(6-phenyl-2-pyridinyl)-10,12,14-triazapentacyclo[11.7.0.03,11.04,9.015,20]icosa-1(13),2,4,6,8,11,15,17,19-nonaene;platinum(2+).
| Compound Name | 10-phenyl-14-(6-phenyl-2-pyridinyl)-10,12,14-triazapentacyclo[11.7.0.03,11.04,9.015,20]icosa-1(13),2,4,6,8,11,15,17,19-nonaene;platinum(2+) |
|---|---|
| PubChem CID | 165164239 |
| Molecular Formula | C34H20N4Pt |
| Molecular Weight | 679.64 g/mol |
| Exact Mass | 679.13 |
| IUPAC Name | 10-phenyl-14-(6-phenyl-2-pyridinyl)-10,12,14-triazapentacyclo[11.7.0.03,11.04,9.015,20]icosa-1(13),2,4,6,8,11,15,17,19-nonaene;platinum(2+) |
| SMILES | [Pt+2].[c-]1ccccc1-c1cccc(-n2c3ccccc3c3cc4c5ccccc5n(-c5[c-]cccc5)c4nc32)n1 |
| InChI | InChI=1S/C34H20N4.Pt/c1-3-12-23(13-4-1)29-18-11-21-32(35-29)38-31-20-10-8-17-26(31)28-22-27-25-16-7-9-19-30(25)37(33(27)36-34(28)38)24-14-5-2-6-15-24;/h1-12,14,16-22H;/q-2;+2 |
| InChIKey | YAHNKGXBAWSSPJ-UHFFFAOYSA-N |
| XLogP | 7.94 |
| TPSA | 35.64 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 679.64 |
| LogP ≤ 5 | 7.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|