C40H32N4Pt — CID 165164185
10-(4-tert-butyl-6-phenyl-2-pyridinyl)-6,18-dimethyl-14-phenyl-10,12,14-triazapentacyclo[11.7.0.03,11.04,9.015,20]icosa-1,3(11),4(9),5,7,12,15(20),16,18-nonaene;platinum(2+) (PubChem CID 165164185) has the molecular formula C40H32N4Pt and a molecular weight of 763.80 g/mol. Its IUPAC name is 10-(4-tert-butyl-6-phenyl-2-pyridinyl)-6,18-dimethyl-14-phenyl-10,12,14-triazapentacyclo[11.7.0.03,11.04,9.015,20]icosa-1,3(11),4(9),5,7,12,15(20),16,18-nonaene;platinum(2+).
| Compound Name | 10-(4-tert-butyl-6-phenyl-2-pyridinyl)-6,18-dimethyl-14-phenyl-10,12,14-triazapentacyclo[11.7.0.03,11.04,9.015,20]icosa-1,3(11),4(9),5,7,12,15(20),16,18-nonaene;platinum(2+) |
|---|---|
| PubChem CID | 165164185 |
| Molecular Formula | C40H32N4Pt |
| Molecular Weight | 763.80 g/mol |
| Exact Mass | 763.23 |
| IUPAC Name | 10-(4-tert-butyl-6-phenyl-2-pyridinyl)-6,18-dimethyl-14-phenyl-10,12,14-triazapentacyclo[11.7.0.03,11.04,9.015,20]icosa-1,3(11),4(9),5,7,12,15(20),16,18-nonaene;platinum(2+) |
| SMILES | Cc1ccc2c(c1)c1cc3c4cc(C)ccc4n(-c4cc(C(C)(C)C)cc(-c5[c-]cccc5)n4)c3nc1n2-c1[c-]cccc1.[Pt+2] |
| InChI | InChI=1S/C40H32N4.Pt/c1-25-16-18-35-30(20-25)32-24-33-31-21-26(2)17-19-36(31)44(39(33)42-38(32)43(35)29-14-10-7-11-15-29)37-23-28(40(3,4)5)22-34(41-37)27-12-8-6-9-13-27;/h6-12,14,16-24H,1-5H3;/q-2;+2 |
| InChIKey | PBKIXNRRTGQPLC-UHFFFAOYSA-N |
| XLogP | 9.85 |
| TPSA | 35.64 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 763.80 |
| LogP ≤ 5 | 9.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|