C41H41N4OPt+ — CID 164823467
2,4-ditert-butyl-6-[3-[2-(9-phenylpyrido[2,3-b]indol-2-yl)propan-2-yl]-2H-benzimidazol-3-ium-2-id-1-yl]phenol;platinum(2+) (PubChem CID 164823467) has the molecular formula C41H41N4OPt+ and a molecular weight of 800.88 g/mol. Its IUPAC name is 2,4-ditert-butyl-6-[3-[2-(9-phenylpyrido[2,3-b]indol-2-yl)propan-2-yl]-2H-benzimidazol-3-ium-2-id-1-yl]phenol;platinum(2+).
| Compound Name | 2,4-ditert-butyl-6-[3-[2-(9-phenylpyrido[2,3-b]indol-2-yl)propan-2-yl]-2H-benzimidazol-3-ium-2-id-1-yl]phenol;platinum(2+) |
|---|---|
| PubChem CID | 164823467 |
| Molecular Formula | C41H41N4OPt+ |
| Molecular Weight | 800.88 g/mol |
| Exact Mass | 800.29 |
| IUPAC Name | 2,4-ditert-butyl-6-[3-[2-(9-phenylpyrido[2,3-b]indol-2-yl)propan-2-yl]-2H-benzimidazol-3-ium-2-id-1-yl]phenol;platinum(2+) |
| SMILES | CC(C)(C)c1cc(-n2[c-][n+](C(C)(C)c3ccc4c5ccccc5n(-c5[c-]cccc5)c4n3)c3ccccc32)c(O)c(C(C)(C)C)c1.[Pt+2] |
| InChI | InChI=1S/C41H41N4O.Pt/c1-39(2,3)27-24-31(40(4,5)6)37(46)35(25-27)43-26-44(34-21-15-14-20-33(34)43)41(7,8)36-23-22-30-29-18-12-13-19-32(29)45(38(30)42-36)28-16-10-9-11-17-28;/h9-16,18-25,46H,1-8H3;/q-1;+2 |
| InChIKey | AJWPHNKRYGKWPQ-UHFFFAOYSA-N |
| XLogP | 9.09 |
| TPSA | 46.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 800.88 |
| LogP ≤ 5 | 9.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|