C39H40N3OPt- — CID 154589915
2,4-ditert-butyl-6-[2-[3-(2-pyridin-2-ylpropan-2-yl)benzene-2-id-1-yl]pyrido[2,3-b]indol-9-yl]phenol;platinum (PubChem CID 154589915) has the molecular formula C39H40N3OPt- and a molecular weight of 761.85 g/mol. Its IUPAC name is 2,4-ditert-butyl-6-[2-[3-(2-pyridin-2-ylpropan-2-yl)benzene-2-id-1-yl]pyrido[2,3-b]indol-9-yl]phenol;platinum.
| Compound Name | 2,4-ditert-butyl-6-[2-[3-(2-pyridin-2-ylpropan-2-yl)benzene-2-id-1-yl]pyrido[2,3-b]indol-9-yl]phenol;platinum |
|---|---|
| PubChem CID | 154589915 |
| Molecular Formula | C39H40N3OPt- |
| Molecular Weight | 761.85 g/mol |
| Exact Mass | 761.28 |
| IUPAC Name | 2,4-ditert-butyl-6-[2-[3-(2-pyridin-2-ylpropan-2-yl)benzene-2-id-1-yl]pyrido[2,3-b]indol-9-yl]phenol;platinum |
| SMILES | CC(C)(C)c1cc(-n2c3ccccc3c3ccc(-c4[c-]c(C(C)(C)c5ccccn5)ccc4)nc32)c(O)c(C(C)(C)C)c1.[Pt] |
| InChI | InChI=1S/C39H40N3O.Pt/c1-37(2,3)27-23-30(38(4,5)6)35(43)33(24-27)42-32-17-10-9-16-28(32)29-19-20-31(41-36(29)42)25-14-13-15-26(22-25)39(7,8)34-18-11-12-21-40-34;/h9-21,23-24,43H,1-8H3;/q-1; |
| InChIKey | VEWGDKVFTBKKLH-UHFFFAOYSA-N |
| XLogP | 9.66 |
| TPSA | 50.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 761.85 |
| LogP ≤ 5 | 9.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|